C29H29ClN2O5 — CID 126267968
N-(3-chloro-4-methylphenyl)-2-[4-(1,8-dioxo-2,3,4,5,6,7,9,10-octahydroacridin-9-yl)-2-methoxyphenoxy]acetamide (PubChem CID 126267968) has the molecular formula C29H29ClN2O5 and a molecular weight of 521.01 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-2-[4-(1,8-dioxo-2,3,4,5,6,7,9,10-octahydroacridin-9-yl)-2-methoxyphenoxy]acetamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-2-[4-(1,8-dioxo-2,3,4,5,6,7,9,10-octahydroacridin-9-yl)-2-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 126267968 |
| Molecular Formula | C29H29ClN2O5 |
| Molecular Weight | 521.01 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-2-[4-(1,8-dioxo-2,3,4,5,6,7,9,10-octahydroacridin-9-yl)-2-methoxyphenoxy]acetamide |
| SMILES | COc1cc(C2C3=C(CCCC3=O)NC3=C2C(=O)CCC3)ccc1OCC(=O)Nc1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C29H29ClN2O5/c1-16-9-11-18(14-19(16)30)31-26(35)15-37-24-12-10-17(13-25(24)36-2)27-28-20(5-3-7-22(28)33)32-21-6-4-8-23(34)29(21)27/h9-14,27,32H,3-8,15H2,1-2H3,(H,31,35) |
| InChIKey | BKUWPFKQWISCBQ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.01 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |