C30H32N2O5 — CID 126265320
N-(2,3-dimethylphenyl)-2-[4-(1,8-dioxo-2,3,4,5,6,7,9,10-octahydroacridin-9-yl)-2-methoxyphenoxy]acetamide (PubChem CID 126265320) has the molecular formula C30H32N2O5 and a molecular weight of 500.60 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-[4-(1,8-dioxo-2,3,4,5,6,7,9,10-octahydroacridin-9-yl)-2-methoxyphenoxy]acetamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-[4-(1,8-dioxo-2,3,4,5,6,7,9,10-octahydroacridin-9-yl)-2-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 126265320 |
| Molecular Formula | C30H32N2O5 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-[4-(1,8-dioxo-2,3,4,5,6,7,9,10-octahydroacridin-9-yl)-2-methoxyphenoxy]acetamide |
| SMILES | COc1cc(C2C3=C(CCCC3=O)NC3=C2C(=O)CCC3)ccc1OCC(=O)Nc1cccc(C)c1C |
| InChI | InChI=1S/C30H32N2O5/c1-17-7-4-8-20(18(17)2)32-27(35)16-37-25-14-13-19(15-26(25)36-3)28-29-21(9-5-11-23(29)33)31-22-10-6-12-24(34)30(22)28/h4,7-8,13-15,28,31H,5-6,9-12,16H2,1-3H3,(H,32,35) |
| InChIKey | ZUZVOBGTWANHJQ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |