C24H25N3O4S — CID 110529670
2-[2-methoxy-4-(5-oxo-2-sulfanylidene-1,3,4,6,7,8-hexahydroquinazolin-4-yl)phenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 110529670) has the molecular formula C24H25N3O4S and a molecular weight of 451.55 g/mol. Its IUPAC name is 2-[2-methoxy-4-(5-oxo-2-sulfanylidene-1,3,4,6,7,8-hexahydroquinazolin-4-yl)phenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[2-methoxy-4-(5-oxo-2-sulfanylidene-1,3,4,6,7,8-hexahydroquinazolin-4-yl)phenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 110529670 |
| Molecular Formula | C24H25N3O4S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 2-[2-methoxy-4-(5-oxo-2-sulfanylidene-1,3,4,6,7,8-hexahydroquinazolin-4-yl)phenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | COc1cc(C2NC(=S)NC3=C2C(=O)CCC3)ccc1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C24H25N3O4S/c1-14-6-9-16(10-7-14)25-21(29)13-31-19-11-8-15(12-20(19)30-2)23-22-17(26-24(32)27-23)4-3-5-18(22)28/h6-12,23H,3-5,13H2,1-2H3,(H,25,29)(H2,26,27,32) |
| InChIKey | QIOUPMADBSCEFC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|