C23H31N3O4S — CID 110529658
2-[2-methoxy-4-(5-oxo-2-sulfanylidene-1,3,4,6,7,8-hexahydroquinazolin-4-yl)phenoxy]-N,N-dipropylacetamide (PubChem CID 110529658) has the molecular formula C23H31N3O4S and a molecular weight of 445.59 g/mol. Its IUPAC name is 2-[2-methoxy-4-(5-oxo-2-sulfanylidene-1,3,4,6,7,8-hexahydroquinazolin-4-yl)phenoxy]-N,N-dipropylacetamide.
| Compound Name | 2-[2-methoxy-4-(5-oxo-2-sulfanylidene-1,3,4,6,7,8-hexahydroquinazolin-4-yl)phenoxy]-N,N-dipropylacetamide |
|---|---|
| PubChem CID | 110529658 |
| Molecular Formula | C23H31N3O4S |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 2-[2-methoxy-4-(5-oxo-2-sulfanylidene-1,3,4,6,7,8-hexahydroquinazolin-4-yl)phenoxy]-N,N-dipropylacetamide |
| SMILES | CCCN(CCC)C(=O)COc1ccc(C2NC(=S)NC3=C2C(=O)CCC3)cc1OC |
| InChI | InChI=1S/C23H31N3O4S/c1-4-11-26(12-5-2)20(28)14-30-18-10-9-15(13-19(18)29-3)22-21-16(24-23(31)25-22)7-6-8-17(21)27/h9-10,13,22H,4-8,11-12,14H2,1-3H3,(H2,24,25,31) |
| InChIKey | YHGZQJISSRJYEL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|