C16H18N2O4 — CID 23968011
4-(3-ethoxy-4-hydroxyphenyl)-1,3,4,6,7,8-hexahydroquinazoline-2,5-dione (PubChem CID 23968011) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is 4-(3-ethoxy-4-hydroxyphenyl)-1,3,4,6,7,8-hexahydroquinazoline-2,5-dione.
| Compound Name | 4-(3-ethoxy-4-hydroxyphenyl)-1,3,4,6,7,8-hexahydroquinazoline-2,5-dione |
|---|---|
| PubChem CID | 23968011 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 4-(3-ethoxy-4-hydroxyphenyl)-1,3,4,6,7,8-hexahydroquinazoline-2,5-dione |
| SMILES | CCOc1cc(C2NC(=O)NC3=C2C(=O)CCC3)ccc1O |
| InChI | InChI=1S/C16H18N2O4/c1-2-22-13-8-9(6-7-11(13)19)15-14-10(17-16(21)18-15)4-3-5-12(14)20/h6-8,15,19H,2-5H2,1H3,(H2,17,18,21) |
| InChIKey | NBSDGWGVQPNVID-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |