C16H18N2O2 — CID 756989
(4S)-4-(4-ethylphenyl)-1,3,4,6,7,8-hexahydroquinazoline-2,5-dione (PubChem CID 756989) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is (4S)-4-(4-ethylphenyl)-1,3,4,6,7,8-hexahydroquinazoline-2,5-dione.
| Compound Name | (4S)-4-(4-ethylphenyl)-1,3,4,6,7,8-hexahydroquinazoline-2,5-dione |
|---|---|
| PubChem CID | 756989 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | (4S)-4-(4-ethylphenyl)-1,3,4,6,7,8-hexahydroquinazoline-2,5-dione |
| SMILES | CCc1ccc([C@@H]2NC(=O)NC3=C2C(=O)CCC3)cc1 |
| InChI | InChI=1S/C16H18N2O2/c1-2-10-6-8-11(9-7-10)15-14-12(17-16(20)18-15)4-3-5-13(14)19/h6-9,15H,2-5H2,1H3,(H2,17,18,20)/t15-/m0/s1 |
| InChIKey | FBXAWSOVWXKEJW-HNNXBMFYSA-N |
| XLogP | 2.61 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |