C15H16N2O3 — CID 10754643
4-(2-methoxyphenyl)-1,3,4,6,7,8-hexahydroquinazoline-2,5-dione (PubChem CID 10754643) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)-1,3,4,6,7,8-hexahydroquinazoline-2,5-dione.
| Compound Name | 4-(2-methoxyphenyl)-1,3,4,6,7,8-hexahydroquinazoline-2,5-dione |
|---|---|
| PubChem CID | 10754643 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 4-(2-methoxyphenyl)-1,3,4,6,7,8-hexahydroquinazoline-2,5-dione |
| SMILES | COc1ccccc1C1NC(=O)NC2=C1C(=O)CCC2 |
| InChI | InChI=1S/C15H16N2O3/c1-20-12-8-3-2-5-9(12)14-13-10(16-15(19)17-14)6-4-7-11(13)18/h2-3,5,8,14H,4,6-7H2,1H3,(H2,16,17,19) |
| InChIKey | LGTROMMITMYQQW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |