C23H20N4O2 — CID 46196862
4-(1,3-diphenylpyrazol-4-yl)-1,3,4,6,7,8-hexahydroquinazoline-2,5-dione (PubChem CID 46196862) has the molecular formula C23H20N4O2 and a molecular weight of 384.44 g/mol. Its IUPAC name is 4-(1,3-diphenylpyrazol-4-yl)-1,3,4,6,7,8-hexahydroquinazoline-2,5-dione.
| Compound Name | 4-(1,3-diphenylpyrazol-4-yl)-1,3,4,6,7,8-hexahydroquinazoline-2,5-dione |
|---|---|
| PubChem CID | 46196862 |
| Molecular Formula | C23H20N4O2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 4-(1,3-diphenylpyrazol-4-yl)-1,3,4,6,7,8-hexahydroquinazoline-2,5-dione |
| SMILES | O=C1NC2=C(C(=O)CCC2)C(c2cn(-c3ccccc3)nc2-c2ccccc2)N1 |
| InChI | InChI=1S/C23H20N4O2/c28-19-13-7-12-18-20(19)22(25-23(29)24-18)17-14-27(16-10-5-2-6-11-16)26-21(17)15-8-3-1-4-9-15/h1-6,8-11,14,22H,7,12-13H2,(H2,24,25,29) |
| InChIKey | UELBUNDDVPGXMI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |