C22H21ClN2O3S — CID 110529597
4-[2-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]-2-sulfanylidene-1,3,4,6,7,8-hexahydroquinazolin-5-one (PubChem CID 110529597) has the molecular formula C22H21ClN2O3S and a molecular weight of 428.94 g/mol. Its IUPAC name is 4-[2-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]-2-sulfanylidene-1,3,4,6,7,8-hexahydroquinazolin-5-one.
| Compound Name | 4-[2-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]-2-sulfanylidene-1,3,4,6,7,8-hexahydroquinazolin-5-one |
|---|---|
| PubChem CID | 110529597 |
| Molecular Formula | C22H21ClN2O3S |
| Molecular Weight | 428.94 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | 4-[2-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]-2-sulfanylidene-1,3,4,6,7,8-hexahydroquinazolin-5-one |
| SMILES | COc1cccc(C2NC(=S)NC3=C2C(=O)CCC3)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C22H21ClN2O3S/c1-27-18-11-4-7-14(21(18)28-12-13-6-2-3-8-15(13)23)20-19-16(24-22(29)25-20)9-5-10-17(19)26/h2-4,6-8,11,20H,5,9-10,12H2,1H3,(H2,24,25,29) |
| InChIKey | WSXMYHJBQGCOLU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.94 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|