C21H18Cl2N2O2S — CID 110529624
4-[2-[(3,4-dichlorophenyl)methoxy]phenyl]-2-sulfanylidene-1,3,4,6,7,8-hexahydroquinazolin-5-one (PubChem CID 110529624) has the molecular formula C21H18Cl2N2O2S and a molecular weight of 433.36 g/mol. Its IUPAC name is 4-[2-[(3,4-dichlorophenyl)methoxy]phenyl]-2-sulfanylidene-1,3,4,6,7,8-hexahydroquinazolin-5-one.
| Compound Name | 4-[2-[(3,4-dichlorophenyl)methoxy]phenyl]-2-sulfanylidene-1,3,4,6,7,8-hexahydroquinazolin-5-one |
|---|---|
| PubChem CID | 110529624 |
| Molecular Formula | C21H18Cl2N2O2S |
| Molecular Weight | 433.36 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | 4-[2-[(3,4-dichlorophenyl)methoxy]phenyl]-2-sulfanylidene-1,3,4,6,7,8-hexahydroquinazolin-5-one |
| SMILES | O=C1CCCC2=C1C(c1ccccc1OCc1ccc(Cl)c(Cl)c1)NC(=S)N2 |
| InChI | InChI=1S/C21H18Cl2N2O2S/c22-14-9-8-12(10-15(14)23)11-27-18-7-2-1-4-13(18)20-19-16(24-21(28)25-20)5-3-6-17(19)26/h1-2,4,7-10,20H,3,5-6,11H2,(H2,24,25,28) |
| InChIKey | JTKXILGPBAYKHR-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.36 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|