C17H16Cl2O2 — CID 60627582
5-[(3,4-dichlorophenyl)methoxy]-1,2,3,4-tetrahydronaphthalen-1-ol (PubChem CID 60627582) has the molecular formula C17H16Cl2O2 and a molecular weight of 323.22 g/mol. Its IUPAC name is 5-[(3,4-dichlorophenyl)methoxy]-1,2,3,4-tetrahydronaphthalen-1-ol.
| Compound Name | 5-[(3,4-dichlorophenyl)methoxy]-1,2,3,4-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 60627582 |
| Molecular Formula | C17H16Cl2O2 |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 5-[(3,4-dichlorophenyl)methoxy]-1,2,3,4-tetrahydronaphthalen-1-ol |
| SMILES | OC1CCCc2c(OCc3ccc(Cl)c(Cl)c3)cccc21 |
| InChI | InChI=1S/C17H16Cl2O2/c18-14-8-7-11(9-15(14)19)10-21-17-6-2-3-12-13(17)4-1-5-16(12)20/h2-3,6-9,16,20H,1,4-5,10H2 |
| InChIKey | MHQGWYAXXUJMFZ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |