C17H17BrO2 — CID 60711761
5-[(2-bromophenyl)methoxy]-1,2,3,4-tetrahydronaphthalen-1-ol (PubChem CID 60711761) has the molecular formula C17H17BrO2 and a molecular weight of 333.23 g/mol. Its IUPAC name is 5-[(2-bromophenyl)methoxy]-1,2,3,4-tetrahydronaphthalen-1-ol.
| Compound Name | 5-[(2-bromophenyl)methoxy]-1,2,3,4-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 60711761 |
| Molecular Formula | C17H17BrO2 |
| Molecular Weight | 333.23 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 5-[(2-bromophenyl)methoxy]-1,2,3,4-tetrahydronaphthalen-1-ol |
| SMILES | OC1CCCc2c(OCc3ccccc3Br)cccc21 |
| InChI | InChI=1S/C17H17BrO2/c18-15-8-2-1-5-12(15)11-20-17-10-4-6-13-14(17)7-3-9-16(13)19/h1-2,4-6,8,10,16,19H,3,7,9,11H2 |
| InChIKey | FFNLTQXBIBLORM-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.23 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |