C16H15BrO2 — CID 63091043
4-[(2-bromophenyl)methoxy]-2,3-dihydro-1H-inden-1-ol (PubChem CID 63091043) has the molecular formula C16H15BrO2 and a molecular weight of 319.20 g/mol. Its IUPAC name is 4-[(2-bromophenyl)methoxy]-2,3-dihydro-1H-inden-1-ol.
| Compound Name | 4-[(2-bromophenyl)methoxy]-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 63091043 |
| Molecular Formula | C16H15BrO2 |
| Molecular Weight | 319.20 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 4-[(2-bromophenyl)methoxy]-2,3-dihydro-1H-inden-1-ol |
| SMILES | OC1CCc2c(OCc3ccccc3Br)cccc21 |
| InChI | InChI=1S/C16H15BrO2/c17-14-6-2-1-4-11(14)10-19-16-7-3-5-12-13(16)8-9-15(12)18/h1-7,15,18H,8-10H2 |
| InChIKey | MZCVKDRDIGTYKM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.20 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |