C18H20O2 — CID 63091389
4-(3-phenylpropoxy)-2,3-dihydro-1H-inden-1-ol (PubChem CID 63091389) has the molecular formula C18H20O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 4-(3-phenylpropoxy)-2,3-dihydro-1H-inden-1-ol.
| Compound Name | 4-(3-phenylpropoxy)-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 63091389 |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 4-(3-phenylpropoxy)-2,3-dihydro-1H-inden-1-ol |
| SMILES | OC1CCc2c(OCCCc3ccccc3)cccc21 |
| InChI | InChI=1S/C18H20O2/c19-17-12-11-16-15(17)9-4-10-18(16)20-13-5-8-14-6-2-1-3-7-14/h1-4,6-7,9-10,17,19H,5,8,11-13H2 |
| InChIKey | IVNUZBIEFXLLEY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|