About 4-but-3-ynoxy-2,3-dihydro-1H-inden-1-ol
4-but-3-ynoxy-2,3-dihydro-1H-inden-1-ol (PubChem CID 63091221) has the molecular formula C13H14O2
and a molecular weight of 202.25 g/mol. Its IUPAC name is 4-but-3-ynoxy-2,3-dihydro-1H-inden-1-ol.
Molecular Properties
| Compound Name | 4-but-3-ynoxy-2,3-dihydro-1H-inden-1-ol |
| PubChem CID | 63091221 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 4-but-3-ynoxy-2,3-dihydro-1H-inden-1-ol |
| SMILES | C#CCCOc1cccc2c1CCC2O |
| InChI | InChI=1S/C13H14O2/c1-2-3-9-15-13-6-4-5-10-11(13)7-8-12(10)14/h1,4-6,12,14H,3,7-9H2 |
| InChIKey | QGQNYSUPFPZPSN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-but-3-ynoxy-2,3-dihydro-1H-inden-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-but-3-ynoxy-2,3-dihydro-1H-inden-1-ol?
The IUPAC name of 4-but-3-ynoxy-2,3-dihydro-1H-inden-1-ol (CID 63091221) is 4-but-3-ynoxy-2,3-dihydro-1H-inden-1-ol.
What is the SMILES notation for 4-but-3-ynoxy-2,3-dihydro-1H-inden-1-ol?
The canonical SMILES for 4-but-3-ynoxy-2,3-dihydro-1H-inden-1-ol is C#CCCOc1cccc2c1CCC2O.
What is the InChIKey of 4-but-3-ynoxy-2,3-dihydro-1H-inden-1-ol?
The InChIKey is QGQNYSUPFPZPSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O2/c1-2-3-9-15-13-6-4-5-10-11(13)7-8-12(10)14/h1,4-6,12,14H,3,7-9H2.
What are the key properties of 4-but-3-ynoxy-2,3-dihydro-1H-inden-1-ol?
4-but-3-ynoxy-2,3-dihydro-1H-inden-1-ol has a molecular weight of 202.25 g/mol, XLogP of 2.07, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-but-3-ynoxy-2,3-dihydro-1H-inden-1-ol is sourced from PubChem (CID 63091221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).