C13H18O4 — CID 55179905
4-[2-(2-hydroxyethoxy)ethoxy]-2,3-dihydro-1H-inden-1-ol (PubChem CID 55179905) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is 4-[2-(2-hydroxyethoxy)ethoxy]-2,3-dihydro-1H-inden-1-ol.
| Compound Name | 4-[2-(2-hydroxyethoxy)ethoxy]-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 55179905 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 4-[2-(2-hydroxyethoxy)ethoxy]-2,3-dihydro-1H-inden-1-ol |
| SMILES | OCCOCCOc1cccc2c1CCC2O |
| InChI | InChI=1S/C13H18O4/c14-6-7-16-8-9-17-13-3-1-2-10-11(13)4-5-12(10)15/h1-3,12,14-15H,4-9H2 |
| InChIKey | AVEBQORRLBUJAK-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|