C18H20O2S — CID 79228032
5-(2-phenylsulfanylethoxy)-1,2,3,4-tetrahydronaphthalen-1-ol (PubChem CID 79228032) has the molecular formula C18H20O2S and a molecular weight of 300.42 g/mol. Its IUPAC name is 5-(2-phenylsulfanylethoxy)-1,2,3,4-tetrahydronaphthalen-1-ol.
| Compound Name | 5-(2-phenylsulfanylethoxy)-1,2,3,4-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 79228032 |
| Molecular Formula | C18H20O2S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 5-(2-phenylsulfanylethoxy)-1,2,3,4-tetrahydronaphthalen-1-ol |
| SMILES | OC1CCCc2c(OCCSc3ccccc3)cccc21 |
| InChI | InChI=1S/C18H20O2S/c19-17-10-4-9-16-15(17)8-5-11-18(16)20-12-13-21-14-6-2-1-3-7-14/h1-3,5-8,11,17,19H,4,9-10,12-13H2 |
| InChIKey | WZTKJDBLMVJBAP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|