C17H23NO2 — CID 65454089
5-[(5-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]-2,2-dimethylpentanenitrile (PubChem CID 65454089) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 5-[(5-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]-2,2-dimethylpentanenitrile.
| Compound Name | 5-[(5-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]-2,2-dimethylpentanenitrile |
|---|---|
| PubChem CID | 65454089 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 5-[(5-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]-2,2-dimethylpentanenitrile |
| SMILES | CC(C)(C#N)CCCOc1cccc2c1CCCC2O |
| InChI | InChI=1S/C17H23NO2/c1-17(2,12-18)10-5-11-20-16-9-4-6-13-14(16)7-3-8-15(13)19/h4,6,9,15,19H,3,5,7-8,10-11H2,1-2H3 |
| InChIKey | WVZLATBQMAVVGL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|