C15H20O3 — CID 106929819
5-(cyclopropylmethoxymethoxy)-1,2,3,4-tetrahydronaphthalen-1-ol (PubChem CID 106929819) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is 5-(cyclopropylmethoxymethoxy)-1,2,3,4-tetrahydronaphthalen-1-ol.
| Compound Name | 5-(cyclopropylmethoxymethoxy)-1,2,3,4-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 106929819 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 5-(cyclopropylmethoxymethoxy)-1,2,3,4-tetrahydronaphthalen-1-ol |
| SMILES | OC1CCCc2c(OCOCC3CC3)cccc21 |
| InChI | InChI=1S/C15H20O3/c16-14-5-1-4-13-12(14)3-2-6-15(13)18-10-17-9-11-7-8-11/h2-3,6,11,14,16H,1,4-5,7-10H2 |
| InChIKey | ROLYRULPKODYNR-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|