C15H19ClO3 — CID 89299936
4-[[(1S,2R,4S)-4-chloro-2-hydroxycyclopentyl]methoxy]-2,3-dihydro-1H-inden-1-ol (PubChem CID 89299936) has the molecular formula C15H19ClO3 and a molecular weight of 282.77 g/mol. Its IUPAC name is 4-[[(1S,2R,4S)-4-chloro-2-hydroxycyclopentyl]methoxy]-2,3-dihydro-1H-inden-1-ol.
| Compound Name | 4-[[(1S,2R,4S)-4-chloro-2-hydroxycyclopentyl]methoxy]-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 89299936 |
| Molecular Formula | C15H19ClO3 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 4-[[(1S,2R,4S)-4-chloro-2-hydroxycyclopentyl]methoxy]-2,3-dihydro-1H-inden-1-ol |
| SMILES | OC1CCc2c(OC[C@@H]3C[C@H](Cl)C[C@H]3O)cccc21 |
| InChI | InChI=1S/C15H19ClO3/c16-10-6-9(14(18)7-10)8-19-15-3-1-2-11-12(15)4-5-13(11)17/h1-3,9-10,13-14,17-18H,4-8H2/t9-,10-,13?,14+/m0/s1 |
| InChIKey | MVCGBWMOYNEEFV-VJFNYOPKSA-N |
| XLogP | 2.42 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|