C16H21NO — CID 65454800
5-but-3-ynoxy-N-ethyl-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 65454800) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is 5-but-3-ynoxy-N-ethyl-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | 5-but-3-ynoxy-N-ethyl-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 65454800 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 5-but-3-ynoxy-N-ethyl-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | C#CCCOc1cccc2c1CCCC2NCC |
| InChI | InChI=1S/C16H21NO/c1-3-5-12-18-16-11-7-8-13-14(16)9-6-10-15(13)17-4-2/h1,7-8,11,15,17H,4-6,9-10,12H2,2H3 |
| InChIKey | DYHFNRQKMVGNBD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|