C15H19NO — CID 65456133
N-ethyl-5-prop-2-ynoxy-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 65456133) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is N-ethyl-5-prop-2-ynoxy-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | N-ethyl-5-prop-2-ynoxy-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 65456133 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | N-ethyl-5-prop-2-ynoxy-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | C#CCOc1cccc2c1CCCC2NCC |
| InChI | InChI=1S/C15H19NO/c1-3-11-17-15-10-6-7-12-13(15)8-5-9-14(12)16-4-2/h1,6-7,10,14,16H,4-5,8-9,11H2,2H3 |
| InChIKey | SXXMWMJVBQBGCZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|