C17H25NO — CID 65454622
5-but-3-enoxy-N-propyl-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 65454622) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is 5-but-3-enoxy-N-propyl-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | 5-but-3-enoxy-N-propyl-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 65454622 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 5-but-3-enoxy-N-propyl-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | C=CCCOc1cccc2c1CCCC2NCCC |
| InChI | InChI=1S/C17H25NO/c1-3-5-13-19-17-11-7-8-14-15(17)9-6-10-16(14)18-12-4-2/h3,7-8,11,16,18H,1,4-6,9-10,12-13H2,2H3 |
| InChIKey | UOCAGLBBTGKGQP-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|