C13H13NO2S — CID 112641052
4-(1,3-thiazol-5-ylmethoxy)-2,3-dihydro-1H-inden-1-ol (PubChem CID 112641052) has the molecular formula C13H13NO2S and a molecular weight of 247.32 g/mol. Its IUPAC name is 4-(1,3-thiazol-5-ylmethoxy)-2,3-dihydro-1H-inden-1-ol.
| Compound Name | 4-(1,3-thiazol-5-ylmethoxy)-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 112641052 |
| Molecular Formula | C13H13NO2S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 4-(1,3-thiazol-5-ylmethoxy)-2,3-dihydro-1H-inden-1-ol |
| SMILES | OC1CCc2c(OCc3cncs3)cccc21 |
| InChI | InChI=1S/C13H13NO2S/c15-12-5-4-11-10(12)2-1-3-13(11)16-7-9-6-14-8-17-9/h1-3,6,8,12,15H,4-5,7H2 |
| InChIKey | DRJSMFRIWZIJAU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |