C17H15BrO2 — CID 65456345
5-[(2-bromophenyl)methoxy]-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 65456345) has the molecular formula C17H15BrO2 and a molecular weight of 331.21 g/mol. Its IUPAC name is 5-[(2-bromophenyl)methoxy]-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 5-[(2-bromophenyl)methoxy]-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 65456345 |
| Molecular Formula | C17H15BrO2 |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 5-[(2-bromophenyl)methoxy]-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | O=C1CCCc2c(OCc3ccccc3Br)cccc21 |
| InChI | InChI=1S/C17H15BrO2/c18-15-8-2-1-5-12(15)11-20-17-10-4-6-13-14(17)7-3-9-16(13)19/h1-2,4-6,8,10H,3,7,9,11H2 |
| InChIKey | UISQLJCWPBKYFA-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |