C17H14BrIO2 — CID 134269995
5-[(2-bromo-5-iodophenyl)methoxy]-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 134269995) has the molecular formula C17H14BrIO2 and a molecular weight of 457.11 g/mol. Its IUPAC name is 5-[(2-bromo-5-iodophenyl)methoxy]-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 5-[(2-bromo-5-iodophenyl)methoxy]-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 134269995 |
| Molecular Formula | C17H14BrIO2 |
| Molecular Weight | 457.11 g/mol |
| Exact Mass | 455.92 |
| IUPAC Name | 5-[(2-bromo-5-iodophenyl)methoxy]-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | O=C1CCCc2c(OCc3cc(I)ccc3Br)cccc21 |
| InChI | InChI=1S/C17H14BrIO2/c18-15-8-7-12(19)9-11(15)10-21-17-6-2-3-13-14(17)4-1-5-16(13)20/h2-3,6-9H,1,4-5,10H2 |
| InChIKey | SIOQZGTVZSRLMT-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.11 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|