About 5-(2-sulfanylethoxy)-3,4-dihydro-2H-naphthalen-1-one
5-(2-sulfanylethoxy)-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 142914123) has the molecular formula C12H14O2S
and a molecular weight of 222.31 g/mol. Its IUPAC name is 5-(2-sulfanylethoxy)-3,4-dihydro-2H-naphthalen-1-one.
Molecular Properties
| Compound Name | 5-(2-sulfanylethoxy)-3,4-dihydro-2H-naphthalen-1-one |
| PubChem CID | 142914123 |
| Molecular Formula | C12H14O2S |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 5-(2-sulfanylethoxy)-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | O=C1CCCc2c(OCCS)cccc21 |
| InChI | InChI=1S/C12H14O2S/c13-11-5-1-4-10-9(11)3-2-6-12(10)14-7-8-15/h2-3,6,15H,1,4-5,7-8H2 |
| InChIKey | XQXZVDFJIAEPCM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-sulfanylethoxy)-3,4-dihydro-2H-naphthalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-sulfanylethoxy)-3,4-dihydro-2H-naphthalen-1-one?
The IUPAC name of 5-(2-sulfanylethoxy)-3,4-dihydro-2H-naphthalen-1-one (CID 142914123) is 5-(2-sulfanylethoxy)-3,4-dihydro-2H-naphthalen-1-one.
What is the SMILES notation for 5-(2-sulfanylethoxy)-3,4-dihydro-2H-naphthalen-1-one?
The canonical SMILES for 5-(2-sulfanylethoxy)-3,4-dihydro-2H-naphthalen-1-one is O=C1CCCc2c(OCCS)cccc21.
What is the InChIKey of 5-(2-sulfanylethoxy)-3,4-dihydro-2H-naphthalen-1-one?
The InChIKey is XQXZVDFJIAEPCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O2S/c13-11-5-1-4-10-9(11)3-2-6-12(10)14-7-8-15/h2-3,6,15H,1,4-5,7-8H2.
What are the key properties of 5-(2-sulfanylethoxy)-3,4-dihydro-2H-naphthalen-1-one?
5-(2-sulfanylethoxy)-3,4-dihydro-2H-naphthalen-1-one has a molecular weight of 222.31 g/mol, XLogP of 2.51, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-sulfanylethoxy)-3,4-dihydro-2H-naphthalen-1-one is sourced from PubChem (CID 142914123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).