C12H14O3 — CID 60705268
4-(2-methoxyethoxy)-2,3-dihydroinden-1-one (PubChem CID 60705268) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is 4-(2-methoxyethoxy)-2,3-dihydroinden-1-one.
| Compound Name | 4-(2-methoxyethoxy)-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 60705268 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 4-(2-methoxyethoxy)-2,3-dihydroinden-1-one |
| SMILES | COCCOc1cccc2c1CCC2=O |
| InChI | InChI=1S/C12H14O3/c1-14-7-8-15-12-4-2-3-9-10(12)5-6-11(9)13/h2-4H,5-8H2,1H3 |
| InChIKey | VHCYINVLJAVMLZ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|