C14H18O2 — CID 63091746
4-(2-methylbutoxy)-2,3-dihydroinden-1-one (PubChem CID 63091746) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 4-(2-methylbutoxy)-2,3-dihydroinden-1-one.
| Compound Name | 4-(2-methylbutoxy)-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 63091746 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 4-(2-methylbutoxy)-2,3-dihydroinden-1-one |
| SMILES | CCC(C)COc1cccc2c1CCC2=O |
| InChI | InChI=1S/C14H18O2/c1-3-10(2)9-16-14-6-4-5-11-12(14)7-8-13(11)15/h4-6,10H,3,7-9H2,1-2H3 |
| InChIKey | RABGWAMXOLRKIY-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |