C15H18O4 — CID 70244273
2-ethyl-4-[(1-oxo-2,3-dihydroinden-4-yl)oxy]butanoic acid (PubChem CID 70244273) has the molecular formula C15H18O4 and a molecular weight of 262.30 g/mol. Its IUPAC name is 2-ethyl-4-[(1-oxo-2,3-dihydroinden-4-yl)oxy]butanoic acid.
| Compound Name | 2-ethyl-4-[(1-oxo-2,3-dihydroinden-4-yl)oxy]butanoic acid |
|---|---|
| PubChem CID | 70244273 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 2-ethyl-4-[(1-oxo-2,3-dihydroinden-4-yl)oxy]butanoic acid |
| SMILES | CCC(CCOc1cccc2c1CCC2=O)C(=O)O |
| InChI | InChI=1S/C15H18O4/c1-2-10(15(17)18)8-9-19-14-5-3-4-11-12(14)6-7-13(11)16/h3-5,10H,2,6-9H2,1H3,(H,17,18) |
| InChIKey | AVSLEBDRANJIGX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |