C17H20O6 — CID 139978684
2-[[5-(2-methoxyethoxy)-3,4-dihydronaphthalen-1-yl]methyl]propanedioic acid (PubChem CID 139978684) has the molecular formula C17H20O6 and a molecular weight of 320.34 g/mol. Its IUPAC name is 2-[[5-(2-methoxyethoxy)-3,4-dihydronaphthalen-1-yl]methyl]propanedioic acid.
| Compound Name | 2-[[5-(2-methoxyethoxy)-3,4-dihydronaphthalen-1-yl]methyl]propanedioic acid |
|---|---|
| PubChem CID | 139978684 |
| Molecular Formula | C17H20O6 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 2-[[5-(2-methoxyethoxy)-3,4-dihydronaphthalen-1-yl]methyl]propanedioic acid |
| SMILES | COCCOc1cccc2c1CCC=C2CC(C(=O)O)C(=O)O |
| InChI | InChI=1S/C17H20O6/c1-22-8-9-23-15-7-3-5-12-11(4-2-6-13(12)15)10-14(16(18)19)17(20)21/h3-5,7,14H,2,6,8-10H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | YXFZMEHUTRIRKM-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|