C13H13FO3 — CID 105497474
2-fluoro-2-(5-methoxy-3,4-dihydronaphthalen-1-yl)acetic acid (PubChem CID 105497474) has the molecular formula C13H13FO3 and a molecular weight of 236.24 g/mol. Its IUPAC name is 2-fluoro-2-(5-methoxy-3,4-dihydronaphthalen-1-yl)acetic acid.
| Compound Name | 2-fluoro-2-(5-methoxy-3,4-dihydronaphthalen-1-yl)acetic acid |
|---|---|
| PubChem CID | 105497474 |
| Molecular Formula | C13H13FO3 |
| Molecular Weight | 236.24 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 2-fluoro-2-(5-methoxy-3,4-dihydronaphthalen-1-yl)acetic acid |
| SMILES | COc1cccc2c1CCC=C2C(F)C(=O)O |
| InChI | InChI=1S/C13H13FO3/c1-17-11-7-3-4-8-9(11)5-2-6-10(8)12(14)13(15)16/h3-4,6-7,12H,2,5H2,1H3,(H,15,16) |
| InChIKey | DUMBOGRRNHYRBO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.24 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |