C14H16O2 — CID 132600226
1-(5-methoxy-3,4-dihydronaphthalen-1-yl)propan-2-one (PubChem CID 132600226) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is 1-(5-methoxy-3,4-dihydronaphthalen-1-yl)propan-2-one.
| Compound Name | 1-(5-methoxy-3,4-dihydronaphthalen-1-yl)propan-2-one |
|---|---|
| PubChem CID | 132600226 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 1-(5-methoxy-3,4-dihydronaphthalen-1-yl)propan-2-one |
| SMILES | COc1cccc2c1CCC=C2CC(C)=O |
| InChI | InChI=1S/C14H16O2/c1-10(15)9-11-5-3-7-13-12(11)6-4-8-14(13)16-2/h4-6,8H,3,7,9H2,1-2H3 |
| InChIKey | SJJZXZCPRHOFHG-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |