C13H13NO3 — CID 54275814
6-methoxy-4,5-dihydro-2H-benzo[e]isoindole-1,3-diol (PubChem CID 54275814) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is 6-methoxy-4,5-dihydro-2H-benzo[e]isoindole-1,3-diol.
| Compound Name | 6-methoxy-4,5-dihydro-2H-benzo[e]isoindole-1,3-diol |
|---|---|
| PubChem CID | 54275814 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 6-methoxy-4,5-dihydro-2H-benzo[e]isoindole-1,3-diol |
| SMILES | COc1cccc2c1CCc1c(O)[nH]c(O)c1-2 |
| InChI | InChI=1S/C13H13NO3/c1-17-10-4-2-3-8-7(10)5-6-9-11(8)13(16)14-12(9)15/h2-4,14-16H,5-6H2,1H3 |
| InChIKey | RNIINGGTDRMWGB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 65.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |