C16H14FNO — CID 145426921
N-(3-fluorophenyl)-4-methoxy-2,3-dihydroinden-1-imine (PubChem CID 145426921) has the molecular formula C16H14FNO and a molecular weight of 255.29 g/mol. Its IUPAC name is N-(3-fluorophenyl)-4-methoxy-2,3-dihydroinden-1-imine.
| Compound Name | N-(3-fluorophenyl)-4-methoxy-2,3-dihydroinden-1-imine |
|---|---|
| PubChem CID | 145426921 |
| Molecular Formula | C16H14FNO |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | N-(3-fluorophenyl)-4-methoxy-2,3-dihydroinden-1-imine |
| SMILES | COc1cccc2c1CC/C2=N\c1cccc(F)c1 |
| InChI | InChI=1S/C16H14FNO/c1-19-16-7-3-6-13-14(16)8-9-15(13)18-12-5-2-4-11(17)10-12/h2-7,10H,8-9H2,1H3/b18-15+ |
| InChIKey | WTDYUSUDRFZNFY-OBGWFSINSA-N |
| XLogP | 3.90 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|