C14H12F2O2 — CID 165476912
1-(2,5-difluorophenyl)-2,3-dimethoxybenzene (PubChem CID 165476912) has the molecular formula C14H12F2O2 and a molecular weight of 250.24 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-2,3-dimethoxybenzene.
| Compound Name | 1-(2,5-difluorophenyl)-2,3-dimethoxybenzene |
|---|---|
| PubChem CID | 165476912 |
| Molecular Formula | C14H12F2O2 |
| Molecular Weight | 250.24 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 1-(2,5-difluorophenyl)-2,3-dimethoxybenzene |
| SMILES | COc1cccc(-c2cc(F)ccc2F)c1OC |
| InChI | InChI=1S/C14H12F2O2/c1-17-13-5-3-4-10(14(13)18-2)11-8-9(15)6-7-12(11)16/h3-8H,1-2H3 |
| InChIKey | AXSOWNPVYVJDJN-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.24 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |