C14H14ClNO2 — CID 82794309
5-chloro-2-(2,3-dimethoxyphenyl)aniline (PubChem CID 82794309) has the molecular formula C14H14ClNO2 and a molecular weight of 263.72 g/mol. Its IUPAC name is 5-chloro-2-(2,3-dimethoxyphenyl)aniline.
| Compound Name | 5-chloro-2-(2,3-dimethoxyphenyl)aniline |
|---|---|
| PubChem CID | 82794309 |
| Molecular Formula | C14H14ClNO2 |
| Molecular Weight | 263.72 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 5-chloro-2-(2,3-dimethoxyphenyl)aniline |
| SMILES | COc1cccc(-c2ccc(Cl)cc2N)c1OC |
| InChI | InChI=1S/C14H14ClNO2/c1-17-13-5-3-4-11(14(13)18-2)10-7-6-9(15)8-12(10)16/h3-8H,16H2,1-2H3 |
| InChIKey | RNHXBDHYMTXJOG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.72 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|