C14H13BrClNO2 — CID 103523654
2-(3-bromo-2,4-dimethoxyphenyl)-4-chloroaniline (PubChem CID 103523654) has the molecular formula C14H13BrClNO2 and a molecular weight of 342.62 g/mol. Its IUPAC name is 2-(3-bromo-2,4-dimethoxyphenyl)-4-chloroaniline.
| Compound Name | 2-(3-bromo-2,4-dimethoxyphenyl)-4-chloroaniline |
|---|---|
| PubChem CID | 103523654 |
| Molecular Formula | C14H13BrClNO2 |
| Molecular Weight | 342.62 g/mol |
| Exact Mass | 340.98 |
| IUPAC Name | 2-(3-bromo-2,4-dimethoxyphenyl)-4-chloroaniline |
| SMILES | COc1ccc(-c2cc(Cl)ccc2N)c(OC)c1Br |
| InChI | InChI=1S/C14H13BrClNO2/c1-18-12-6-4-9(14(19-2)13(12)15)10-7-8(16)3-5-11(10)17/h3-7H,17H2,1-2H3 |
| InChIKey | SMHRWKWCZGRADK-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.62 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|