C15H14ClNO3S — CID 62492869
5-chloro-2-(2,6-dimethoxyphenoxy)benzenecarbothioamide (PubChem CID 62492869) has the molecular formula C15H14ClNO3S and a molecular weight of 323.80 g/mol. Its IUPAC name is 5-chloro-2-(2,6-dimethoxyphenoxy)benzenecarbothioamide.
| Compound Name | 5-chloro-2-(2,6-dimethoxyphenoxy)benzenecarbothioamide |
|---|---|
| PubChem CID | 62492869 |
| Molecular Formula | C15H14ClNO3S |
| Molecular Weight | 323.80 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 5-chloro-2-(2,6-dimethoxyphenoxy)benzenecarbothioamide |
| SMILES | COc1cccc(OC)c1Oc1ccc(Cl)cc1C(N)=S |
| InChI | InChI=1S/C15H14ClNO3S/c1-18-12-4-3-5-13(19-2)14(12)20-11-7-6-9(16)8-10(11)15(17)21/h3-8H,1-2H3,(H2,17,21) |
| InChIKey | BSYGEVYTJVGCIP-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.80 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|