C12H17N3OS — CID 163502816
amino-[2-(5-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)hydrazinyl]methanethiol (PubChem CID 163502816) has the molecular formula C12H17N3OS and a molecular weight of 251.36 g/mol. Its IUPAC name is amino-[2-(5-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)hydrazinyl]methanethiol.
| Compound Name | amino-[2-(5-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)hydrazinyl]methanethiol |
|---|---|
| PubChem CID | 163502816 |
| Molecular Formula | C12H17N3OS |
| Molecular Weight | 251.36 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | amino-[2-(5-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)hydrazinyl]methanethiol |
| SMILES | COc1cccc2c1CCCC2=NNC(N)S |
| InChI | InChI=1S/C12H17N3OS/c1-16-11-7-3-4-8-9(11)5-2-6-10(8)14-15-12(13)17/h3-4,7,12,15,17H,2,5-6,13H2,1H3 |
| InChIKey | CWEDQQXCHFPSQH-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.36 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|