C24H27N3O2S — CID 123974278
N-[(5-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)amino]-4-[3-(1-methoxypropyl)phenyl]-1,3-thiazol-2-amine (PubChem CID 123974278) has the molecular formula C24H27N3O2S and a molecular weight of 421.57 g/mol. Its IUPAC name is N-[(5-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)amino]-4-[3-(1-methoxypropyl)phenyl]-1,3-thiazol-2-amine.
| Compound Name | N-[(5-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)amino]-4-[3-(1-methoxypropyl)phenyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 123974278 |
| Molecular Formula | C24H27N3O2S |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | N-[(5-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)amino]-4-[3-(1-methoxypropyl)phenyl]-1,3-thiazol-2-amine |
| SMILES | CCC(OC)c1cccc(-c2csc(NN=C3CCCc4c(OC)cccc43)n2)c1 |
| InChI | InChI=1S/C24H27N3O2S/c1-4-22(28-2)17-9-5-8-16(14-17)21-15-30-24(25-21)27-26-20-12-6-11-19-18(20)10-7-13-23(19)29-3/h5,7-10,13-15,22H,4,6,11-12H2,1-3H3,(H,25,27) |
| InChIKey | GLQYOXCJZPRHOX-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 55.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|