C18H18N2OS — CID 2536248
4-(2-methoxyphenyl)-N-[(1S)-1-phenylethyl]-1,3-thiazol-2-amine (PubChem CID 2536248) has the molecular formula C18H18N2OS and a molecular weight of 310.42 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)-N-[(1S)-1-phenylethyl]-1,3-thiazol-2-amine.
| Compound Name | 4-(2-methoxyphenyl)-N-[(1S)-1-phenylethyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 2536248 |
| Molecular Formula | C18H18N2OS |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 4-(2-methoxyphenyl)-N-[(1S)-1-phenylethyl]-1,3-thiazol-2-amine |
| SMILES | COc1ccccc1-c1csc(N[C@@H](C)c2ccccc2)n1 |
| InChI | InChI=1S/C18H18N2OS/c1-13(14-8-4-3-5-9-14)19-18-20-16(12-22-18)15-10-6-7-11-17(15)21-2/h3-13H,1-2H3,(H,19,20)/t13-/m0/s1 |
| InChIKey | XCPUNGSBKOGZME-ZDUSSCGKSA-N |
| XLogP | 4.99 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |