C19H20N2O2S — CID 7529068
4-(2,4-dimethoxyphenyl)-N-[(1R)-1-phenylethyl]-1,3-thiazol-2-amine (PubChem CID 7529068) has the molecular formula C19H20N2O2S and a molecular weight of 340.45 g/mol. Its IUPAC name is 4-(2,4-dimethoxyphenyl)-N-[(1R)-1-phenylethyl]-1,3-thiazol-2-amine.
| Compound Name | 4-(2,4-dimethoxyphenyl)-N-[(1R)-1-phenylethyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 7529068 |
| Molecular Formula | C19H20N2O2S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 4-(2,4-dimethoxyphenyl)-N-[(1R)-1-phenylethyl]-1,3-thiazol-2-amine |
| SMILES | COc1ccc(-c2csc(N[C@H](C)c3ccccc3)n2)c(OC)c1 |
| InChI | InChI=1S/C19H20N2O2S/c1-13(14-7-5-4-6-8-14)20-19-21-17(12-24-19)16-10-9-15(22-2)11-18(16)23-3/h4-13H,1-3H3,(H,20,21)/t13-/m1/s1 |
| InChIKey | MXXPURMNUYCQEP-CYBMUJFWSA-N |
| XLogP | 5.00 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |