C23H20N2S — CID 2464196
N-[(1R)-1-phenylethyl]-4-(4-phenylphenyl)-1,3-thiazol-2-amine (PubChem CID 2464196) has the molecular formula C23H20N2S and a molecular weight of 356.49 g/mol. Its IUPAC name is N-[(1R)-1-phenylethyl]-4-(4-phenylphenyl)-1,3-thiazol-2-amine.
| Compound Name | N-[(1R)-1-phenylethyl]-4-(4-phenylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 2464196 |
| Molecular Formula | C23H20N2S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | N-[(1R)-1-phenylethyl]-4-(4-phenylphenyl)-1,3-thiazol-2-amine |
| SMILES | C[C@@H](Nc1nc(-c2ccc(-c3ccccc3)cc2)cs1)c1ccccc1 |
| InChI | InChI=1S/C23H20N2S/c1-17(18-8-4-2-5-9-18)24-23-25-22(16-26-23)21-14-12-20(13-15-21)19-10-6-3-7-11-19/h2-17H,1H3,(H,24,25)/t17-/m1/s1 |
| InChIKey | MQEVWWPWIYYXBJ-QGZVFWFLSA-N |
| XLogP | 6.65 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |