C19H17N3OS — CID 9343382
5-[2-[[(1R)-1-phenylethyl]amino]-1,3-thiazol-4-yl]-1,3-dihydroindol-2-one (PubChem CID 9343382) has the molecular formula C19H17N3OS and a molecular weight of 335.43 g/mol. Its IUPAC name is 5-[2-[[(1R)-1-phenylethyl]amino]-1,3-thiazol-4-yl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[2-[[(1R)-1-phenylethyl]amino]-1,3-thiazol-4-yl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 9343382 |
| Molecular Formula | C19H17N3OS |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 5-[2-[[(1R)-1-phenylethyl]amino]-1,3-thiazol-4-yl]-1,3-dihydroindol-2-one |
| SMILES | C[C@@H](Nc1nc(-c2ccc3c(c2)CC(=O)N3)cs1)c1ccccc1 |
| InChI | InChI=1S/C19H17N3OS/c1-12(13-5-3-2-4-6-13)20-19-22-17(11-24-19)14-7-8-16-15(9-14)10-18(23)21-16/h2-9,11-12H,10H2,1H3,(H,20,22)(H,21,23)/t12-/m1/s1 |
| InChIKey | QVGICOGWLCEEDM-GFCCVEGCSA-N |
| XLogP | 4.48 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |