C18H13N3O2S — CID 108797869
2-oxo-N-(4-phenyl-1,3-thiazol-2-yl)-1,3-dihydroindole-5-carboxamide (PubChem CID 108797869) has the molecular formula C18H13N3O2S and a molecular weight of 335.39 g/mol. Its IUPAC name is 2-oxo-N-(4-phenyl-1,3-thiazol-2-yl)-1,3-dihydroindole-5-carboxamide.
| Compound Name | 2-oxo-N-(4-phenyl-1,3-thiazol-2-yl)-1,3-dihydroindole-5-carboxamide |
|---|---|
| PubChem CID | 108797869 |
| Molecular Formula | C18H13N3O2S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 2-oxo-N-(4-phenyl-1,3-thiazol-2-yl)-1,3-dihydroindole-5-carboxamide |
| SMILES | O=C1Cc2cc(C(=O)Nc3nc(-c4ccccc4)cs3)ccc2N1 |
| InChI | InChI=1S/C18H13N3O2S/c22-16-9-13-8-12(6-7-14(13)19-16)17(23)21-18-20-15(10-24-18)11-4-2-1-3-5-11/h1-8,10H,9H2,(H,19,22)(H,20,21,23) |
| InChIKey | YNXPPONKYAQIBS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |