C17H13N3O3S2 — CID 9055823
2-oxo-N-(4-phenyl-1,3-thiazol-2-yl)-1,3-dihydroindole-5-sulfonamide (PubChem CID 9055823) has the molecular formula C17H13N3O3S2 and a molecular weight of 371.44 g/mol. Its IUPAC name is 2-oxo-N-(4-phenyl-1,3-thiazol-2-yl)-1,3-dihydroindole-5-sulfonamide.
| Compound Name | 2-oxo-N-(4-phenyl-1,3-thiazol-2-yl)-1,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 9055823 |
| Molecular Formula | C17H13N3O3S2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | 2-oxo-N-(4-phenyl-1,3-thiazol-2-yl)-1,3-dihydroindole-5-sulfonamide |
| SMILES | O=C1Cc2cc(S(=O)(=O)Nc3nc(-c4ccccc4)cs3)ccc2N1 |
| InChI | InChI=1S/C17H13N3O3S2/c21-16-9-12-8-13(6-7-14(12)18-16)25(22,23)20-17-19-15(10-24-17)11-4-2-1-3-5-11/h1-8,10H,9H2,(H,18,21)(H,19,20) |
| InChIKey | UPQZMZQFQJPFMR-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'} |
|---|