C19H16N4O4S2 — CID 22109313
N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-2,4-dioxo-1,5-dihydro-1,5-benzodiazepine-7-sulfonamide (PubChem CID 22109313) has the molecular formula C19H16N4O4S2 and a molecular weight of 428.50 g/mol. Its IUPAC name is N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-2,4-dioxo-1,5-dihydro-1,5-benzodiazepine-7-sulfonamide.
| Compound Name | N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-2,4-dioxo-1,5-dihydro-1,5-benzodiazepine-7-sulfonamide |
|---|---|
| PubChem CID | 22109313 |
| Molecular Formula | C19H16N4O4S2 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-2,4-dioxo-1,5-dihydro-1,5-benzodiazepine-7-sulfonamide |
| SMILES | Cc1nc(-c2cccc(NS(=O)(=O)c3ccc4c(c3)NC(=O)CC(=O)N4)c2)cs1 |
| InChI | InChI=1S/C19H16N4O4S2/c1-11-20-17(10-28-11)12-3-2-4-13(7-12)23-29(26,27)14-5-6-15-16(8-14)22-19(25)9-18(24)21-15/h2-8,10,23H,9H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | TZXHEBNYNOJECM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|