C10H11N3O2S2 — CID 112573268
2-methyl-4-[3-(sulfamoylamino)phenyl]-1,3-thiazole (PubChem CID 112573268) has the molecular formula C10H11N3O2S2 and a molecular weight of 269.35 g/mol. Its IUPAC name is 2-methyl-4-[3-(sulfamoylamino)phenyl]-1,3-thiazole.
| Compound Name | 2-methyl-4-[3-(sulfamoylamino)phenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 112573268 |
| Molecular Formula | C10H11N3O2S2 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | 2-methyl-4-[3-(sulfamoylamino)phenyl]-1,3-thiazole |
| SMILES | Cc1nc(-c2cccc(NS(N)(=O)=O)c2)cs1 |
| InChI | InChI=1S/C10H11N3O2S2/c1-7-12-10(6-16-7)8-3-2-4-9(5-8)13-17(11,14)15/h2-6,13H,1H3,(H2,11,14,15) |
| InChIKey | IVFIURQGIRRCRQ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |