C18H16N2O4S2 — CID 8823584
4-methyl-3-[[3-(2-methyl-1,3-thiazol-4-yl)phenyl]sulfamoyl]benzoic acid (PubChem CID 8823584) has the molecular formula C18H16N2O4S2 and a molecular weight of 388.47 g/mol. Its IUPAC name is 4-methyl-3-[[3-(2-methyl-1,3-thiazol-4-yl)phenyl]sulfamoyl]benzoic acid.
| Compound Name | 4-methyl-3-[[3-(2-methyl-1,3-thiazol-4-yl)phenyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 8823584 |
| Molecular Formula | C18H16N2O4S2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 4-methyl-3-[[3-(2-methyl-1,3-thiazol-4-yl)phenyl]sulfamoyl]benzoic acid |
| SMILES | Cc1nc(-c2cccc(NS(=O)(=O)c3cc(C(=O)O)ccc3C)c2)cs1 |
| InChI | InChI=1S/C18H16N2O4S2/c1-11-6-7-14(18(21)22)9-17(11)26(23,24)20-15-5-3-4-13(8-15)16-10-25-12(2)19-16/h3-10,20H,1-2H3,(H,21,22) |
| InChIKey | MIGUSXKSOLPGBB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |